C23H37FN4O3 — CID 109475253
1-ethyl-3-[2-(3-fluorophenoxy)butyl]-2-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]guanidine (PubChem CID 109475253) has the molecular formula C23H37FN4O3 and a molecular weight of 436.57 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenoxy)butyl]-2-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenoxy)butyl]-2-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 109475253 |
| Molecular Formula | C23H37FN4O3 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenoxy)butyl]-2-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C1CCOC1)N1CCOCC1)NCC(CC)Oc1cccc(F)c1 |
| InChI | InChI=1S/C23H37FN4O3/c1-3-20(31-21-7-5-6-19(24)14-21)15-26-23(25-4-2)27-16-22(18-8-11-30-17-18)28-9-12-29-13-10-28/h5-7,14,18,20,22H,3-4,8-13,15-17H2,1-2H3,(H2,25,26,27) |
| InChIKey | HYAOGKXJGVUPTI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|