C22H38FN5O — CID 109475557
1-ethyl-2-[2-(3-fluorophenoxy)butyl]-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine (PubChem CID 109475557) has the molecular formula C22H38FN5O and a molecular weight of 407.58 g/mol. Its IUPAC name is 1-ethyl-2-[2-(3-fluorophenoxy)butyl]-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(3-fluorophenoxy)butyl]-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 109475557 |
| Molecular Formula | C22H38FN5O |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.31 |
| IUPAC Name | 1-ethyl-2-[2-(3-fluorophenoxy)butyl]-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC(CC)Oc1cccc(F)c1)NCCCN1CCCN(C)CC1 |
| InChI | InChI=1S/C22H38FN5O/c1-4-20(29-21-10-6-9-19(23)17-21)18-26-22(24-5-2)25-11-7-13-28-14-8-12-27(3)15-16-28/h6,9-10,17,20H,4-5,7-8,11-16,18H2,1-3H3,(H2,24,25,26) |
| InChIKey | NOTOQBOWVCLOEO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|