C19H33FN4O3S — CID 109475585
1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-[2-(3-fluorophenoxy)butyl]guanidine (PubChem CID 109475585) has the molecular formula C19H33FN4O3S and a molecular weight of 416.56 g/mol. Its IUPAC name is 1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-[2-(3-fluorophenoxy)butyl]guanidine.
| Compound Name | 1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-[2-(3-fluorophenoxy)butyl]guanidine |
|---|---|
| PubChem CID | 109475585 |
| Molecular Formula | C19H33FN4O3S |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-[2-(3-fluorophenoxy)butyl]guanidine |
| SMILES | CCN/C(=N\CC(CC)Oc1cccc(F)c1)NCCCN(C)S(=O)(=O)CC |
| InChI | InChI=1S/C19H33FN4O3S/c1-5-17(27-18-11-8-10-16(20)14-18)15-23-19(21-6-2)22-12-9-13-24(4)28(25,26)7-3/h8,10-11,14,17H,5-7,9,12-13,15H2,1-4H3,(H2,21,22,23) |
| InChIKey | ZFGZPEZUVMEETF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|