C21H30FIN4O3S — CID 109475566
1-ethyl-2-[2-(3-fluorophenoxy)butyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 109475566) has the molecular formula C21H30FIN4O3S and a molecular weight of 564.47 g/mol. Its IUPAC name is 1-ethyl-2-[2-(3-fluorophenoxy)butyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(3-fluorophenoxy)butyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109475566 |
| Molecular Formula | C21H30FIN4O3S |
| Molecular Weight | 564.47 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | 1-ethyl-2-[2-(3-fluorophenoxy)butyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CC)Oc1cccc(F)c1)NCCc1ccc(S(N)(=O)=O)cc1.I |
| InChI | InChI=1S/C21H29FN4O3S.HI/c1-3-18(29-19-7-5-6-17(22)14-19)15-26-21(24-4-2)25-13-12-16-8-10-20(11-9-16)30(23,27)28;/h5-11,14,18H,3-4,12-13,15H2,1-2H3,(H2,23,27,28)(H2,24,25,26);1H |
| InChIKey | BRILDACMEDJHJW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|