C23H35FIN5OS — CID 109475922
1-[2-(3-fluorophenoxy)butyl]-2-methyl-3-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 109475922) has the molecular formula C23H35FIN5OS and a molecular weight of 575.54 g/mol. Its IUPAC name is 1-[2-(3-fluorophenoxy)butyl]-2-methyl-3-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-fluorophenoxy)butyl]-2-methyl-3-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109475922 |
| Molecular Formula | C23H35FIN5OS |
| Molecular Weight | 575.54 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | 1-[2-(3-fluorophenoxy)butyl]-2-methyl-3-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCC(CN/C(=N\C)NCC1CCN(Cc2csc(C)n2)CC1)Oc1cccc(F)c1.I |
| InChI | InChI=1S/C23H34FN5OS.HI/c1-4-21(30-22-7-5-6-19(24)12-22)14-27-23(25-3)26-13-18-8-10-29(11-9-18)15-20-16-31-17(2)28-20;/h5-7,12,16,18,21H,4,8-11,13-15H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | DLXCGHQFKSMIKF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|