C20H32FN3O2 — CID 109476099
1-[2-(3-fluorophenoxy)butyl]-3-[[1-(2-methoxyethyl)cyclobutyl]methyl]-2-methylguanidine (PubChem CID 109476099) has the molecular formula C20H32FN3O2 and a molecular weight of 365.49 g/mol. Its IUPAC name is 1-[2-(3-fluorophenoxy)butyl]-3-[[1-(2-methoxyethyl)cyclobutyl]methyl]-2-methylguanidine.
| Compound Name | 1-[2-(3-fluorophenoxy)butyl]-3-[[1-(2-methoxyethyl)cyclobutyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109476099 |
| Molecular Formula | C20H32FN3O2 |
| Molecular Weight | 365.49 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 1-[2-(3-fluorophenoxy)butyl]-3-[[1-(2-methoxyethyl)cyclobutyl]methyl]-2-methylguanidine |
| SMILES | CCC(CN/C(=N/C)NCC1(CCOC)CCC1)Oc1cccc(F)c1 |
| InChI | InChI=1S/C20H32FN3O2/c1-4-17(26-18-8-5-7-16(21)13-18)14-23-19(22-2)24-15-20(9-6-10-20)11-12-25-3/h5,7-8,13,17H,4,6,9-12,14-15H2,1-3H3,(H2,22,23,24) |
| InChIKey | AVQSCSURTWJEAW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|