C22H35N5O3 — CID 109476509
N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[[1-(2-hydroxyethyl)cyclohexyl]methylamino]methylidene]amino]methyl]benzamide (PubChem CID 109476509) has the molecular formula C22H35N5O3 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[[1-(2-hydroxyethyl)cyclohexyl]methylamino]methylidene]amino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[[1-(2-hydroxyethyl)cyclohexyl]methylamino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 109476509 |
| Molecular Formula | C22H35N5O3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[[1-(2-hydroxyethyl)cyclohexyl]methylamino]methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NCC(N)=O)cc1)NCC1(CCO)CCCCC1 |
| InChI | InChI=1S/C22H35N5O3/c1-2-24-21(27-16-22(12-13-28)10-4-3-5-11-22)26-14-17-6-8-18(9-7-17)20(30)25-15-19(23)29/h6-9,28H,2-5,10-16H2,1H3,(H2,23,29)(H,25,30)(H2,24,26,27) |
| InChIKey | DZHUIBLLHSLPHZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|