C18H24O6 — CID 10947678
methyl (E)-3-methyl-4,5-dioxo-5-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)pent-2-enoate (PubChem CID 10947678) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is methyl (E)-3-methyl-4,5-dioxo-5-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)pent-2-enoate.
| Compound Name | methyl (E)-3-methyl-4,5-dioxo-5-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)pent-2-enoate |
|---|---|
| PubChem CID | 10947678 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | methyl (E)-3-methyl-4,5-dioxo-5-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)pent-2-enoate |
| SMILES | COC(=O)/C=C(\C)C(=O)C(=O)C1=C(C)CCC2(OCCO2)C1(C)C |
| InChI | InChI=1S/C18H24O6/c1-11-6-7-18(23-8-9-24-18)17(3,4)14(11)16(21)15(20)12(2)10-13(19)22-5/h10H,6-9H2,1-5H3/b12-10+ |
| InChIKey | PKEPBUKKIBPXGI-ZRDIBKRKSA-N |
| XLogP | 2.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|