C18H28O5 — CID 10903433
5-[(3E,5E)-7-(2-methoxyethoxymethoxy)-2,2-dimethylhepta-3,5-dienyl]-3-methylideneoxolan-2-one (PubChem CID 10903433) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is 5-[(3E,5E)-7-(2-methoxyethoxymethoxy)-2,2-dimethylhepta-3,5-dienyl]-3-methylideneoxolan-2-one.
| Compound Name | 5-[(3E,5E)-7-(2-methoxyethoxymethoxy)-2,2-dimethylhepta-3,5-dienyl]-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 10903433 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 5-[(3E,5E)-7-(2-methoxyethoxymethoxy)-2,2-dimethylhepta-3,5-dienyl]-3-methylideneoxolan-2-one |
| SMILES | C=C1CC(CC(C)(C)/C=C/C=C/COCOCCOC)OC1=O |
| InChI | InChI=1S/C18H28O5/c1-15-12-16(23-17(15)19)13-18(2,3)8-6-5-7-9-21-14-22-11-10-20-4/h5-8,16H,1,9-14H2,2-4H3/b7-5+,8-6+ |
| InChIKey | BJGLUDMZTOTSOJ-KQQUZDAGSA-N |
| XLogP | 3.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|