C20H34O6 — CID 134872670
methyl (8E,10E)-4-hydroxy-12-(2-methoxyethoxymethoxy)-7,7-dimethyl-2-methylidenedodeca-8,10-dienoate (PubChem CID 134872670) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is methyl (8E,10E)-4-hydroxy-12-(2-methoxyethoxymethoxy)-7,7-dimethyl-2-methylidenedodeca-8,10-dienoate.
| Compound Name | methyl (8E,10E)-4-hydroxy-12-(2-methoxyethoxymethoxy)-7,7-dimethyl-2-methylidenedodeca-8,10-dienoate |
|---|---|
| PubChem CID | 134872670 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | methyl (8E,10E)-4-hydroxy-12-(2-methoxyethoxymethoxy)-7,7-dimethyl-2-methylidenedodeca-8,10-dienoate |
| SMILES | C=C(CC(O)CCC(C)(C)/C=C/C=C/COCOCCOC)C(=O)OC |
| InChI | InChI=1S/C20H34O6/c1-17(19(22)24-5)15-18(21)9-11-20(2,3)10-7-6-8-12-25-16-26-14-13-23-4/h6-8,10,18,21H,1,9,11-16H2,2-5H3/b8-6+,10-7+ |
| InChIKey | CAOXWJMLDMHPTA-NBANWCDVSA-N |
| XLogP | 3.02 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|