C14H22O3 — CID 134892575
methyl (7E)-4-hydroxy-6,6-dimethyl-2-methylidenedeca-7,9-dienoate (PubChem CID 134892575) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is methyl (7E)-4-hydroxy-6,6-dimethyl-2-methylidenedeca-7,9-dienoate.
| Compound Name | methyl (7E)-4-hydroxy-6,6-dimethyl-2-methylidenedeca-7,9-dienoate |
|---|---|
| PubChem CID | 134892575 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | methyl (7E)-4-hydroxy-6,6-dimethyl-2-methylidenedeca-7,9-dienoate |
| SMILES | C=C/C=C/C(C)(C)CC(O)CC(=C)C(=O)OC |
| InChI | InChI=1S/C14H22O3/c1-6-7-8-14(3,4)10-12(15)9-11(2)13(16)17-5/h6-8,12,15H,1-2,9-10H2,3-5H3/b8-7+ |
| InChIKey | LCSXTNACBXUVAT-BQYQJAHWSA-N |
| XLogP | 2.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|