C14H18O5 — CID 134995497
methyl 2-[4-ethenyl-4-(hydroxymethyl)-2-methoxy-6-oxocyclohexen-1-yl]prop-2-enoate (PubChem CID 134995497) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is methyl 2-[4-ethenyl-4-(hydroxymethyl)-2-methoxy-6-oxocyclohexen-1-yl]prop-2-enoate.
| Compound Name | methyl 2-[4-ethenyl-4-(hydroxymethyl)-2-methoxy-6-oxocyclohexen-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 134995497 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | methyl 2-[4-ethenyl-4-(hydroxymethyl)-2-methoxy-6-oxocyclohexen-1-yl]prop-2-enoate |
| SMILES | C=CC1(CO)CC(=O)C(C(=C)C(=O)OC)=C(OC)C1 |
| InChI | InChI=1S/C14H18O5/c1-5-14(8-15)6-10(16)12(11(7-14)18-3)9(2)13(17)19-4/h5,15H,1-2,6-8H2,3-4H3 |
| InChIKey | RKTFVKWOBDQQFE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|