C18H24O4 — CID 145222524
5-hydroxy-1,3-dimethyl-2-[(1E,3E,5E)-3-methyl-7-oxoocta-1,3,5-trienyl]cyclohex-2-ene-1-carboxylic acid (PubChem CID 145222524) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 5-hydroxy-1,3-dimethyl-2-[(1E,3E,5E)-3-methyl-7-oxoocta-1,3,5-trienyl]cyclohex-2-ene-1-carboxylic acid.
| Compound Name | 5-hydroxy-1,3-dimethyl-2-[(1E,3E,5E)-3-methyl-7-oxoocta-1,3,5-trienyl]cyclohex-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 145222524 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 5-hydroxy-1,3-dimethyl-2-[(1E,3E,5E)-3-methyl-7-oxoocta-1,3,5-trienyl]cyclohex-2-ene-1-carboxylic acid |
| SMILES | CC(=O)/C=C/C=C(C)/C=C/C1=C(C)CC(O)CC1(C)C(=O)O |
| InChI | InChI=1S/C18H24O4/c1-12(6-5-7-14(3)19)8-9-16-13(2)10-15(20)11-18(16,4)17(21)22/h5-9,15,20H,10-11H2,1-4H3,(H,21,22)/b7-5+,9-8+,12-6+ |
| InChIKey | ZCSRJKJRMUZONE-WHNYXICFSA-N |
| XLogP | 3.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|