C17H24O6 — CID 54716501
diethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate (PubChem CID 54716501) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is diethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate.
| Compound Name | diethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate |
|---|---|
| PubChem CID | 54716501 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | diethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-3-methylbut-2-enedioate |
| SMILES | CCOC(=O)C(C)=C(C(=O)OCC)C1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C17H24O6/c1-6-22-15(20)10(3)13(16(21)23-7-2)14-11(18)8-17(4,5)9-12(14)19/h18H,6-9H2,1-5H3 |
| InChIKey | UUKSDFLZGNZACL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|