C15H24O3 — CID 10988770
ethyl (7E)-4-hydroxy-6,6-dimethyl-2-methylidenedeca-7,9-dienoate (PubChem CID 10988770) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is ethyl (7E)-4-hydroxy-6,6-dimethyl-2-methylidenedeca-7,9-dienoate.
| Compound Name | ethyl (7E)-4-hydroxy-6,6-dimethyl-2-methylidenedeca-7,9-dienoate |
|---|---|
| PubChem CID | 10988770 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | ethyl (7E)-4-hydroxy-6,6-dimethyl-2-methylidenedeca-7,9-dienoate |
| SMILES | C=C/C=C/C(C)(C)CC(O)CC(=C)C(=O)OCC |
| InChI | InChI=1S/C15H24O3/c1-6-8-9-15(4,5)11-13(16)10-12(3)14(17)18-7-2/h6,8-9,13,16H,1,3,7,10-11H2,2,4-5H3/b9-8+ |
| InChIKey | LQMQLFOOJHTSHP-CMDGGOBGSA-N |
| XLogP | 3.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|