C21H36O6 — CID 11811093
ethyl (8E,10E)-4-hydroxy-12-(2-methoxyethoxymethoxy)-7,7-dimethyl-2-methylidenedodeca-8,10-dienoate (PubChem CID 11811093) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is ethyl (8E,10E)-4-hydroxy-12-(2-methoxyethoxymethoxy)-7,7-dimethyl-2-methylidenedodeca-8,10-dienoate.
| Compound Name | ethyl (8E,10E)-4-hydroxy-12-(2-methoxyethoxymethoxy)-7,7-dimethyl-2-methylidenedodeca-8,10-dienoate |
|---|---|
| PubChem CID | 11811093 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | ethyl (8E,10E)-4-hydroxy-12-(2-methoxyethoxymethoxy)-7,7-dimethyl-2-methylidenedodeca-8,10-dienoate |
| SMILES | C=C(CC(O)CCC(C)(C)/C=C/C=C/COCOCCOC)C(=O)OCC |
| InChI | InChI=1S/C21H36O6/c1-6-27-20(23)18(2)16-19(22)10-12-21(3,4)11-8-7-9-13-25-17-26-15-14-24-5/h7-9,11,19,22H,2,6,10,12-17H2,1,3-5H3/b9-7+,11-8+ |
| InChIKey | UXFURKAMRNFSOL-BIZFVBGRSA-N |
| XLogP | 3.41 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|