C19H35N3 — CID 10947846
1-[2-(cyclohexen-1-yl)ethyl]-2-(3,7-dimethyloct-6-enyl)guanidine (PubChem CID 10947846) has the molecular formula C19H35N3 and a molecular weight of 305.51 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-2-(3,7-dimethyloct-6-enyl)guanidine.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-(3,7-dimethyloct-6-enyl)guanidine |
|---|---|
| PubChem CID | 10947846 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-(3,7-dimethyloct-6-enyl)guanidine |
| SMILES | CC(C)=CCCC(C)CC/N=C(\N)NCCC1=CCCCC1 |
| InChI | InChI=1S/C19H35N3/c1-16(2)8-7-9-17(3)12-14-21-19(20)22-15-13-18-10-5-4-6-11-18/h8,10,17H,4-7,9,11-15H2,1-3H3,(H3,20,21,22) |
| InChIKey | UWXAYPGSDGYFNF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|