C13H17F2NO2 — CID 109478990
2,4-difluoro-N-(1-hydroxypentan-3-yl)-5-methylbenzamide (PubChem CID 109478990) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is 2,4-difluoro-N-(1-hydroxypentan-3-yl)-5-methylbenzamide.
| Compound Name | 2,4-difluoro-N-(1-hydroxypentan-3-yl)-5-methylbenzamide |
|---|---|
| PubChem CID | 109478990 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2,4-difluoro-N-(1-hydroxypentan-3-yl)-5-methylbenzamide |
| SMILES | CCC(CCO)NC(=O)c1cc(C)c(F)cc1F |
| InChI | InChI=1S/C13H17F2NO2/c1-3-9(4-5-17)16-13(18)10-6-8(2)11(14)7-12(10)15/h6-7,9,17H,3-5H2,1-2H3,(H,16,18) |
| InChIKey | YJGWQTZUCZUIIW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |