C13H14F2N2O — CID 113249764
N-(1-cyanobutyl)-2,4-difluoro-5-methylbenzamide (PubChem CID 113249764) has the molecular formula C13H14F2N2O and a molecular weight of 252.26 g/mol. Its IUPAC name is N-(1-cyanobutyl)-2,4-difluoro-5-methylbenzamide.
| Compound Name | N-(1-cyanobutyl)-2,4-difluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 113249764 |
| Molecular Formula | C13H14F2N2O |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-(1-cyanobutyl)-2,4-difluoro-5-methylbenzamide |
| SMILES | CCCC(C#N)NC(=O)c1cc(C)c(F)cc1F |
| InChI | InChI=1S/C13H14F2N2O/c1-3-4-9(7-16)17-13(18)10-5-8(2)11(14)6-12(10)15/h5-6,9H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | VVIBEVRSBTVXDH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |