C10H18FNO2 — CID 109479082
2-fluoro-N-(1-hydroxypentan-3-yl)-3-methylbut-2-enamide (PubChem CID 109479082) has the molecular formula C10H18FNO2 and a molecular weight of 203.26 g/mol. Its IUPAC name is 2-fluoro-N-(1-hydroxypentan-3-yl)-3-methylbut-2-enamide.
| Compound Name | 2-fluoro-N-(1-hydroxypentan-3-yl)-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 109479082 |
| Molecular Formula | C10H18FNO2 |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-fluoro-N-(1-hydroxypentan-3-yl)-3-methylbut-2-enamide |
| SMILES | CCC(CCO)NC(=O)C(F)=C(C)C |
| InChI | InChI=1S/C10H18FNO2/c1-4-8(5-6-13)12-10(14)9(11)7(2)3/h8,13H,4-6H2,1-3H3,(H,12,14) |
| InChIKey | IRCJEUUCGVKSLC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|