C25H30N4O3 — CID 109480747
N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide (PubChem CID 109480747) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide.
| Compound Name | N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109480747 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide |
| SMILES | C/N=C(\NCCCCN1C(=O)c2ccccc2C1=O)N1CCOC(c2ccccc2C)C1 |
| InChI | InChI=1S/C25H30N4O3/c1-18-9-3-4-10-19(18)22-17-28(15-16-32-22)25(26-2)27-13-7-8-14-29-23(30)20-11-5-6-12-21(20)24(29)31/h3-6,9-12,22H,7-8,13-17H2,1-2H3,(H,26,27) |
| InChIKey | FUHXZRBJDSKEAA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|