C24H34IN3O4 — CID 109480867
N'-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethyl-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide (PubChem CID 109480867) has the molecular formula C24H34IN3O4 and a molecular weight of 555.46 g/mol. Its IUPAC name is N'-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethyl-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethyl-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109480867 |
| Molecular Formula | C24H34IN3O4 |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | N'-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-N-ethyl-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)ccc1OC)N1CCOC(c2ccccc2C)C1.I |
| InChI | InChI=1S/C24H33N3O4.HI/c1-5-25-24(26-15-21(28)20-14-18(29-3)10-11-22(20)30-4)27-12-13-31-23(16-27)19-9-7-6-8-17(19)2;/h6-11,14,21,23,28H,5,12-13,15-16H2,1-4H3,(H,25,26);1H |
| InChIKey | FAKDXIXWHSXSDA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|