C13H19BrO6 — CID 10948114
1-O,1-O-diethyl 4-O-methyl (E)-1-(bromomethyl)but-3-ene-1,1,4-tricarboxylate (PubChem CID 10948114) has the molecular formula C13H19BrO6 and a molecular weight of 351.19 g/mol. Its IUPAC name is 1-O,1-O-diethyl 4-O-methyl (E)-1-(bromomethyl)but-3-ene-1,1,4-tricarboxylate.
| Compound Name | 1-O,1-O-diethyl 4-O-methyl (E)-1-(bromomethyl)but-3-ene-1,1,4-tricarboxylate |
|---|---|
| PubChem CID | 10948114 |
| Molecular Formula | C13H19BrO6 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 1-O,1-O-diethyl 4-O-methyl (E)-1-(bromomethyl)but-3-ene-1,1,4-tricarboxylate |
| SMILES | CCOC(=O)C(CBr)(C/C=C/C(=O)OC)C(=O)OCC |
| InChI | InChI=1S/C13H19BrO6/c1-4-19-11(16)13(9-14,12(17)20-5-2)8-6-7-10(15)18-3/h6-7H,4-5,8-9H2,1-3H3/b7-6+ |
| InChIKey | AXZZRIKQKHSCMR-VOTSOKGWSA-N |
| XLogP | 1.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|