C15H22Br2O6 — CID 10647527
diethyl 2,2-bis[(E)-3-bromo-2-methoxyprop-2-enyl]propanedioate (PubChem CID 10647527) has the molecular formula C15H22Br2O6 and a molecular weight of 458.14 g/mol. Its IUPAC name is diethyl 2,2-bis[(E)-3-bromo-2-methoxyprop-2-enyl]propanedioate.
| Compound Name | diethyl 2,2-bis[(E)-3-bromo-2-methoxyprop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 10647527 |
| Molecular Formula | C15H22Br2O6 |
| Molecular Weight | 458.14 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | diethyl 2,2-bis[(E)-3-bromo-2-methoxyprop-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(C/C(=C\Br)OC)(C/C(=C\Br)OC)C(=O)OCC |
| InChI | InChI=1S/C15H22Br2O6/c1-5-22-13(18)15(14(19)23-6-2,7-11(9-16)20-3)8-12(10-17)21-4/h9-10H,5-8H2,1-4H3/b11-9+,12-10+ |
| InChIKey | SEFULPATQQQITQ-WGDLNXRISA-N |
| XLogP | 3.64 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.14 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|