C26H33N5O — CID 109481703
N-ethyl-N'-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-2-(2-methylphenyl)morpholine-4-carboximidamide (PubChem CID 109481703) has the molecular formula C26H33N5O and a molecular weight of 431.58 g/mol. Its IUPAC name is N-ethyl-N'-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-2-(2-methylphenyl)morpholine-4-carboximidamide.
| Compound Name | N-ethyl-N'-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-2-(2-methylphenyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109481703 |
| Molecular Formula | C26H33N5O |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | N-ethyl-N'-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-2-(2-methylphenyl)morpholine-4-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(Cn2ccnc2C)c1)N1CCOC(c2ccccc2C)C1 |
| InChI | InChI=1S/C26H33N5O/c1-4-27-26(31-14-15-32-25(19-31)24-11-6-5-8-20(24)2)29-17-22-9-7-10-23(16-22)18-30-13-12-28-21(30)3/h5-13,16,25H,4,14-15,17-19H2,1-3H3,(H,27,29) |
| InChIKey | UQXARGWYAPTXDM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|