About 1-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol
1-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol (PubChem CID 109481930) has the molecular formula C19H36N4O
and a molecular weight of 336.52 g/mol. Its IUPAC name is 1-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol |
| PubChem CID | 109481930 |
| Molecular Formula | C19H36N4O |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.29 |
| IUPAC Name | 1-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol |
| SMILES | Cc1nn(C(C)(C)C)c(C)c1CNCC(O)CN1CCC(C)CC1 |
| InChI | InChI=1S/C19H36N4O/c1-14-7-9-22(10-8-14)13-17(24)11-20-12-18-15(2)21-23(16(18)3)19(4,5)6/h14,17,20,24H,7-13H2,1-6H3 |
| InChIKey | AUXPZBXVYQVRTL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol?
The IUPAC name of 1-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol (CID 109481930) is 1-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol.
What is the SMILES notation for 1-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol?
The canonical SMILES for 1-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol is Cc1nn(C(C)(C)C)c(C)c1CNCC(O)CN1CCC(C)CC1.
What is the InChIKey of 1-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol?
The InChIKey is AUXPZBXVYQVRTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36N4O/c1-14-7-9-22(10-8-14)13-17(24)11-20-12-18-15(2)21-23(16(18)3)19(4,5)6/h14,17,20,24H,7-13H2,1-6H3.
What are the key properties of 1-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol?
1-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol has a molecular weight of 336.52 g/mol, XLogP of 2.44, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol is sourced from PubChem (CID 109481930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).