C16H25FN2O — CID 110904890
1-[(4-fluorophenyl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol (PubChem CID 110904890) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol.
| Compound Name | 1-[(4-fluorophenyl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 110904890 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-[(4-fluorophenyl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol |
| SMILES | CC1CCN(CC(O)CNCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H25FN2O/c1-13-6-8-19(9-7-13)12-16(20)11-18-10-14-2-4-15(17)5-3-14/h2-5,13,16,18,20H,6-12H2,1H3 |
| InChIKey | MGGYDTLXKGQZMQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |