C17H27N3O4 — CID 110905261
1-[(4-methoxy-3-nitrophenyl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol (PubChem CID 110905261) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-[(4-methoxy-3-nitrophenyl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol.
| Compound Name | 1-[(4-methoxy-3-nitrophenyl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 110905261 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1-[(4-methoxy-3-nitrophenyl)methylamino]-3-(4-methylpiperidin-1-yl)propan-2-ol |
| SMILES | COc1ccc(CNCC(O)CN2CCC(C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H27N3O4/c1-13-5-7-19(8-6-13)12-15(21)11-18-10-14-3-4-17(24-2)16(9-14)20(22)23/h3-4,9,13,15,18,21H,5-8,10-12H2,1-2H3 |
| InChIKey | HOBDOSMVVZOAAR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|