C14H22N2O4 — CID 111119053
1-[(4-methoxy-3-nitrophenyl)methylamino]-3-methylpentan-2-ol (PubChem CID 111119053) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1-[(4-methoxy-3-nitrophenyl)methylamino]-3-methylpentan-2-ol.
| Compound Name | 1-[(4-methoxy-3-nitrophenyl)methylamino]-3-methylpentan-2-ol |
|---|---|
| PubChem CID | 111119053 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1-[(4-methoxy-3-nitrophenyl)methylamino]-3-methylpentan-2-ol |
| SMILES | CCC(C)C(O)CNCc1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H22N2O4/c1-4-10(2)13(17)9-15-8-11-5-6-14(20-3)12(7-11)16(18)19/h5-7,10,13,15,17H,4,8-9H2,1-3H3 |
| InChIKey | SCDZWAUAEGSUDL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|