C14H22N2O5 — CID 82833768
3-[4-[(2-methylpropylamino)methyl]-2-nitrophenoxy]propane-1,2-diol (PubChem CID 82833768) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-[4-[(2-methylpropylamino)methyl]-2-nitrophenoxy]propane-1,2-diol.
| Compound Name | 3-[4-[(2-methylpropylamino)methyl]-2-nitrophenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 82833768 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 3-[4-[(2-methylpropylamino)methyl]-2-nitrophenoxy]propane-1,2-diol |
| SMILES | CC(C)CNCc1ccc(OCC(O)CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H22N2O5/c1-10(2)6-15-7-11-3-4-14(13(5-11)16(19)20)21-9-12(18)8-17/h3-5,10,12,15,17-18H,6-9H2,1-2H3 |
| InChIKey | RQMRKSXENLGSEA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|