C17H31F3N4O — CID 109482452
2-[[N-(4-cyclohexylbutan-2-yl)-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 109482452) has the molecular formula C17H31F3N4O and a molecular weight of 364.46 g/mol. Its IUPAC name is 2-[[N-(4-cyclohexylbutan-2-yl)-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[N-(4-cyclohexylbutan-2-yl)-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 109482452 |
| Molecular Formula | C17H31F3N4O |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 2-[[N-(4-cyclohexylbutan-2-yl)-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C/N=C(\NCC(=O)N(C)CC(F)(F)F)NC(C)CCC1CCCCC1 |
| InChI | InChI=1S/C17H31F3N4O/c1-13(9-10-14-7-5-4-6-8-14)23-16(21-2)22-11-15(25)24(3)12-17(18,19)20/h13-14H,4-12H2,1-3H3,(H2,21,22,23) |
| InChIKey | ODXNMFGQMGJGEU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|