C18H36N4O — CID 109482919
1-hept-6-enyl-1,2-dimethyl-3-(4-morpholin-4-ylbutyl)guanidine (PubChem CID 109482919) has the molecular formula C18H36N4O and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-hept-6-enyl-1,2-dimethyl-3-(4-morpholin-4-ylbutyl)guanidine.
| Compound Name | 1-hept-6-enyl-1,2-dimethyl-3-(4-morpholin-4-ylbutyl)guanidine |
|---|---|
| PubChem CID | 109482919 |
| Molecular Formula | C18H36N4O |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.29 |
| IUPAC Name | 1-hept-6-enyl-1,2-dimethyl-3-(4-morpholin-4-ylbutyl)guanidine |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCCCCN1CCOCC1 |
| InChI | InChI=1S/C18H36N4O/c1-4-5-6-7-9-12-21(3)18(19-2)20-11-8-10-13-22-14-16-23-17-15-22/h4H,1,5-17H2,2-3H3,(H,19,20) |
| InChIKey | LYWMTZYJGGWPNA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|