C18H32N6 — CID 109483011
1-hept-6-enyl-1,2-dimethyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine (PubChem CID 109483011) has the molecular formula C18H32N6 and a molecular weight of 332.50 g/mol. Its IUPAC name is 1-hept-6-enyl-1,2-dimethyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine.
| Compound Name | 1-hept-6-enyl-1,2-dimethyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109483011 |
| Molecular Formula | C18H32N6 |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | 1-hept-6-enyl-1,2-dimethyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C18H32N6/c1-4-5-6-7-10-13-23(3)18(19-2)20-15-17-22-21-16-12-9-8-11-14-24(16)17/h4H,1,5-15H2,2-3H3,(H,19,20) |
| InChIKey | UUGYVCFCILAMFT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|