C15H31N3O — CID 109483077
1-hept-6-enyl-3-(2-methoxy-2-methylpropyl)-1,2-dimethylguanidine (PubChem CID 109483077) has the molecular formula C15H31N3O and a molecular weight of 269.43 g/mol. Its IUPAC name is 1-hept-6-enyl-3-(2-methoxy-2-methylpropyl)-1,2-dimethylguanidine.
| Compound Name | 1-hept-6-enyl-3-(2-methoxy-2-methylpropyl)-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109483077 |
| Molecular Formula | C15H31N3O |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.25 |
| IUPAC Name | 1-hept-6-enyl-3-(2-methoxy-2-methylpropyl)-1,2-dimethylguanidine |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCC(C)(C)OC |
| InChI | InChI=1S/C15H31N3O/c1-7-8-9-10-11-12-18(5)14(16-4)17-13-15(2,3)19-6/h7H,1,8-13H2,2-6H3,(H,16,17) |
| InChIKey | SPMZROOIDBPTSI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|