C16H34IN3O — CID 109483106
3-ethyl-1-hept-6-enyl-2-(2-methoxy-2-methylpropyl)-1-methylguanidine;hydroiodide (PubChem CID 109483106) has the molecular formula C16H34IN3O and a molecular weight of 411.37 g/mol. Its IUPAC name is 3-ethyl-1-hept-6-enyl-2-(2-methoxy-2-methylpropyl)-1-methylguanidine;hydroiodide.
| Compound Name | 3-ethyl-1-hept-6-enyl-2-(2-methoxy-2-methylpropyl)-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109483106 |
| Molecular Formula | C16H34IN3O |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 3-ethyl-1-hept-6-enyl-2-(2-methoxy-2-methylpropyl)-1-methylguanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N\CC(C)(C)OC)NCC.I |
| InChI | InChI=1S/C16H33N3O.HI/c1-7-9-10-11-12-13-19(5)15(17-8-2)18-14-16(3,4)20-6;/h7H,1,8-14H2,2-6H3,(H,17,18);1H |
| InChIKey | RDOZBWWQGHWIET-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|