C17H36IN3O — CID 109483164
3-ethyl-1-hept-6-enyl-2-(5-methoxypentyl)-1-methylguanidine;hydroiodide (PubChem CID 109483164) has the molecular formula C17H36IN3O and a molecular weight of 425.40 g/mol. Its IUPAC name is 3-ethyl-1-hept-6-enyl-2-(5-methoxypentyl)-1-methylguanidine;hydroiodide.
| Compound Name | 3-ethyl-1-hept-6-enyl-2-(5-methoxypentyl)-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109483164 |
| Molecular Formula | C17H36IN3O |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-ethyl-1-hept-6-enyl-2-(5-methoxypentyl)-1-methylguanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N\CCCCCOC)NCC.I |
| InChI | InChI=1S/C17H35N3O.HI/c1-5-7-8-9-12-15-20(3)17(18-6-2)19-14-11-10-13-16-21-4;/h5H,1,6-16H2,2-4H3,(H,18,19);1H |
| InChIKey | SDRSOTGYDQNVDS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|