C20H39N5O — CID 109483229
1-[3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 109483229) has the molecular formula C20H39N5O and a molecular weight of 365.57 g/mol. Its IUPAC name is 1-[3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-[3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 109483229 |
| Molecular Formula | C20H39N5O |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.32 |
| IUPAC Name | 1-[3-[(N-hept-6-enyl-N,N'-dimethylcarbamimidoyl)amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCCCN1CCCC1C(=O)N(C)C |
| InChI | InChI=1S/C20H39N5O/c1-6-7-8-9-10-15-24(5)20(21-2)22-14-12-17-25-16-11-13-18(25)19(26)23(3)4/h6,18H,1,7-17H2,2-5H3,(H,21,22) |
| InChIKey | OJKNIKYUSOOSGN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|