C20H38IN5O2 — CID 109483372
3-ethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-1-hept-6-enyl-1-methylguanidine;hydroiodide (PubChem CID 109483372) has the molecular formula C20H38IN5O2 and a molecular weight of 507.46 g/mol. Its IUPAC name is 3-ethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-1-hept-6-enyl-1-methylguanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-1-hept-6-enyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109483372 |
| Molecular Formula | C20H38IN5O2 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 3-ethyl-2-[3-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)propyl]-1-hept-6-enyl-1-methylguanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N/CCCN1C(=O)NC(C)(CC)C1=O)NCC.I |
| InChI | InChI=1S/C20H37N5O2.HI/c1-6-9-10-11-12-15-24(5)18(21-8-3)22-14-13-16-25-17(26)20(4,7-2)23-19(25)27;/h6H,1,7-16H2,2-5H3,(H,21,22)(H,23,27);1H |
| InChIKey | FDOLBNMUNMCJCD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|