C16H30IN5O2 — CID 109483572
2-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-1-hept-6-enyl-1-methylguanidine;hydroiodide (PubChem CID 109483572) has the molecular formula C16H30IN5O2 and a molecular weight of 451.35 g/mol. Its IUPAC name is 2-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-1-hept-6-enyl-1-methylguanidine;hydroiodide.
| Compound Name | 2-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-1-hept-6-enyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109483572 |
| Molecular Formula | C16H30IN5O2 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-ethyl-1-hept-6-enyl-1-methylguanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N/CCN1C(=O)CNC1=O)NCC.I |
| InChI | InChI=1S/C16H29N5O2.HI/c1-4-6-7-8-9-11-20(3)15(17-5-2)18-10-12-21-14(22)13-19-16(21)23;/h4H,1,5-13H2,2-3H3,(H,17,18)(H,19,23);1H |
| InChIKey | WNKOLPLKAXTDSI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|