C21H39IN6 — CID 109483362
3-ethyl-1-hept-6-enyl-1-methyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide (PubChem CID 109483362) has the molecular formula C21H39IN6 and a molecular weight of 502.49 g/mol. Its IUPAC name is 3-ethyl-1-hept-6-enyl-1-methyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109483362 |
| Molecular Formula | C21H39IN6 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N/CCCc1nnc2n1CCCCC2)NCC.I |
| InChI | InChI=1S/C21H38N6.HI/c1-4-6-7-8-11-17-26(3)21(22-5-2)23-16-13-15-20-25-24-19-14-10-9-12-18-27(19)20;/h4H,1,5-18H2,2-3H3,(H,22,23);1H |
| InChIKey | ZBBOHSONHRXRTD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|