C19H35N5O — CID 109483863
3-ethyl-1-hept-6-enyl-1-methyl-2-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine (PubChem CID 109483863) has the molecular formula C19H35N5O and a molecular weight of 349.52 g/mol. Its IUPAC name is 3-ethyl-1-hept-6-enyl-1-methyl-2-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine.
| Compound Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
|---|---|
| PubChem CID | 109483863 |
| Molecular Formula | C19H35N5O |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
| SMILES | C=CCCCCCN(C)/C(=N/CCCc1nc(C(C)C)no1)NCC |
| InChI | InChI=1S/C19H35N5O/c1-6-8-9-10-11-15-24(5)19(20-7-2)21-14-12-13-17-22-18(16(3)4)23-25-17/h6,16H,1,7-15H2,2-5H3,(H,20,21) |
| InChIKey | DOIPPFVNKZRPSG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|