C17H35N5 — CID 109484367
3-[(1,4-dimethylpiperazin-2-yl)methyl]-1-hept-6-enyl-1,2-dimethylguanidine (PubChem CID 109484367) has the molecular formula C17H35N5 and a molecular weight of 309.50 g/mol. Its IUPAC name is 3-[(1,4-dimethylpiperazin-2-yl)methyl]-1-hept-6-enyl-1,2-dimethylguanidine.
| Compound Name | 3-[(1,4-dimethylpiperazin-2-yl)methyl]-1-hept-6-enyl-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109484367 |
| Molecular Formula | C17H35N5 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.29 |
| IUPAC Name | 3-[(1,4-dimethylpiperazin-2-yl)methyl]-1-hept-6-enyl-1,2-dimethylguanidine |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCC1CN(C)CCN1C |
| InChI | InChI=1S/C17H35N5/c1-6-7-8-9-10-11-22(5)17(18-2)19-14-16-15-20(3)12-13-21(16)4/h6,16H,1,7-15H2,2-5H3,(H,18,19) |
| InChIKey | HMHAMIJKGVAZGN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|