C21H33IN4O2S — CID 109484619
N-[3-[[[ethylamino-(2-ethylthiomorpholin-4-yl)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide (PubChem CID 109484619) has the molecular formula C21H33IN4O2S and a molecular weight of 532.49 g/mol. Its IUPAC name is N-[3-[[[ethylamino-(2-ethylthiomorpholin-4-yl)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-(2-ethylthiomorpholin-4-yl)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109484619 |
| Molecular Formula | C21H33IN4O2S |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | N-[3-[[[ethylamino-(2-ethylthiomorpholin-4-yl)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCCO2)c1)N1CCSC(CC)C1.I |
| InChI | InChI=1S/C21H32N4O2S.HI/c1-3-18-15-25(10-12-28-18)21(22-4-2)23-14-16-7-5-8-17(13-16)24-20(26)19-9-6-11-27-19;/h5,7-8,13,18-19H,3-4,6,9-12,14-15H2,1-2H3,(H,22,23)(H,24,26);1H |
| InChIKey | WEOBTQPURLOHJQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|