C18H25IN4OS — CID 109485064
2-[[C-(2-ethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide (PubChem CID 109485064) has the molecular formula C18H25IN4OS and a molecular weight of 472.40 g/mol. Its IUPAC name is 2-[[C-(2-ethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide.
| Compound Name | 2-[[C-(2-ethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 109485064 |
| Molecular Formula | C18H25IN4OS |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 2-[[C-(2-ethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide |
| SMILES | C#Cc1cccc(NC(=O)CN/C(=N\C)N2CCSC(CC)C2)c1.I |
| InChI | InChI=1S/C18H24N4OS.HI/c1-4-14-7-6-8-15(11-14)21-17(23)12-20-18(19-3)22-9-10-24-16(5-2)13-22;/h1,6-8,11,16H,5,9-10,12-13H2,2-3H3,(H,19,20)(H,21,23);1H |
| InChIKey | GMFHAMGGSDMVND-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|