C20H30O7 — CID 10948954
[(2S,4R,8R)-2-[(1S)-1-acetyloxyheptyl]-8-hydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-4-yl] acetate (PubChem CID 10948954) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is [(2S,4R,8R)-2-[(1S)-1-acetyloxyheptyl]-8-hydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-4-yl] acetate.
| Compound Name | [(2S,4R,8R)-2-[(1S)-1-acetyloxyheptyl]-8-hydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-4-yl] acetate |
|---|---|
| PubChem CID | 10948954 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | [(2S,4R,8R)-2-[(1S)-1-acetyloxyheptyl]-8-hydroxy-5-oxo-2,3,4,6,7,8-hexahydrochromen-4-yl] acetate |
| SMILES | CCCCCC[C@H](OC(C)=O)[C@@H]1C[C@@H](OC(C)=O)C2=C(O1)[C@H](O)CCC2=O |
| InChI | InChI=1S/C20H30O7/c1-4-5-6-7-8-16(25-12(2)21)17-11-18(26-13(3)22)19-14(23)9-10-15(24)20(19)27-17/h15-18,24H,4-11H2,1-3H3/t15-,16+,17+,18-/m1/s1 |
| InChIKey | POXAISUELDLKHG-VSZNYVQBSA-N |
| XLogP | 2.59 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|