C15H30N2O3 — CID 109491442
1-(4-hydroxy-2,2-dimethylpentyl)-3-[1-(oxolan-2-yl)propyl]urea (PubChem CID 109491442) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-(4-hydroxy-2,2-dimethylpentyl)-3-[1-(oxolan-2-yl)propyl]urea.
| Compound Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-[1-(oxolan-2-yl)propyl]urea |
|---|---|
| PubChem CID | 109491442 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-[1-(oxolan-2-yl)propyl]urea |
| SMILES | CCC(NC(=O)NCC(C)(C)CC(C)O)C1CCCO1 |
| InChI | InChI=1S/C15H30N2O3/c1-5-12(13-7-6-8-20-13)17-14(19)16-10-15(3,4)9-11(2)18/h11-13,18H,5-10H2,1-4H3,(H2,16,17,19) |
| InChIKey | BEAGPRGRGHBHMH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |