C21H24F2N6O2 — CID 109495021
1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine (PubChem CID 109495021) has the molecular formula C21H24F2N6O2 and a molecular weight of 430.46 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109495021 |
| Molecular Formula | C21H24F2N6O2 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2cncn2)cc1)NCC(O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H24F2N6O2/c1-2-25-21(26-11-15-3-7-17(8-4-15)29-14-24-13-28-29)27-12-19(30)16-5-9-18(10-6-16)31-20(22)23/h3-10,13-14,19-20,30H,2,11-12H2,1H3,(H2,25,26,27) |
| InChIKey | JYUMFFFAQOIAAZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|