C22H37N5O — CID 109497188
3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-1,2-dimethyl-1-pent-4-enylguanidine (PubChem CID 109497188) has the molecular formula C22H37N5O and a molecular weight of 387.57 g/mol. Its IUPAC name is 3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-1,2-dimethyl-1-pent-4-enylguanidine.
| Compound Name | 3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-1,2-dimethyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109497188 |
| Molecular Formula | C22H37N5O |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.30 |
| IUPAC Name | 3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-1,2-dimethyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCCCN1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C22H37N5O/c1-5-6-7-14-25(3)22(23-2)24-13-8-15-26-16-18-27(19-17-26)20-9-11-21(28-4)12-10-20/h5,9-12H,1,6-8,13-19H2,2-4H3,(H,23,24) |
| InChIKey | SXPXZLJUBTVNJC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|