C21H35IN4O — CID 109498099
3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109498099) has the molecular formula C21H35IN4O and a molecular weight of 486.44 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109498099 |
| Molecular Formula | C21H35IN4O |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\C)NCC(c1ccc(OC)cc1)N1CCCC1.I |
| InChI | InChI=1S/C21H34N4O.HI/c1-5-6-7-14-24(3)21(22-2)23-17-20(25-15-8-9-16-25)18-10-12-19(26-4)13-11-18;/h5,10-13,20H,1,6-9,14-17H2,2-4H3,(H,22,23);1H |
| InChIKey | LBCPZCJHSJOGAF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|