C18H28BrIN4O — CID 109497592
3-bromo-N-[3-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]propyl]benzamide;hydroiodide (PubChem CID 109497592) has the molecular formula C18H28BrIN4O and a molecular weight of 523.26 g/mol. Its IUPAC name is 3-bromo-N-[3-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]propyl]benzamide;hydroiodide.
| Compound Name | 3-bromo-N-[3-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]propyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 109497592 |
| Molecular Formula | C18H28BrIN4O |
| Molecular Weight | 523.26 g/mol |
| Exact Mass | 522.05 |
| IUPAC Name | 3-bromo-N-[3-[(N,N'-dimethyl-N-pent-4-enylcarbamimidoyl)amino]propyl]benzamide;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\C)NCCCNC(=O)c1cccc(Br)c1.I |
| InChI | InChI=1S/C18H27BrN4O.HI/c1-4-5-6-13-23(3)18(20-2)22-12-8-11-21-17(24)15-9-7-10-16(19)14-15;/h4,7,9-10,14H,1,5-6,8,11-13H2,2-3H3,(H,20,22)(H,21,24);1H |
| InChIKey | WNCWVWQYDSGSCM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|